About N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide
N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide (PubChem CID 141417936) has the molecular formula C11H13BrF2N2
and a molecular weight of 291.14 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide.
Molecular Properties
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide |
| PubChem CID | 141417936 |
| Molecular Formula | C11H13BrF2N2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide |
| SMILES | CCC/N=C(\C)Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H13BrF2N2/c1-3-4-15-7(2)16-11-9(13)5-8(12)6-10(11)14/h5-6H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | OUOHEDDGQUIYFX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide?
The IUPAC name of N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide (CID 141417936) is N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide.
What is the SMILES notation for N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide?
The canonical SMILES for N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide is CCC/N=C(\C)Nc1c(F)cc(Br)cc1F.
What is the InChIKey of N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide?
The InChIKey is OUOHEDDGQUIYFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrF2N2/c1-3-4-15-7(2)16-11-9(13)5-8(12)6-10(11)14/h5-6H,3-4H2,1-2H3,(H,15,16).
What are the key properties of N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide?
N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide has a molecular weight of 291.14 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2,6-difluorophenyl)-N'-propylethanimidamide is sourced from PubChem (CID 141417936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).