C18H27NO9S2 — CID 141417957
ethyl (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbamoyl]-3-methylsulfonyl-3-(4-methylsulfonylphenyl)propanoate (PubChem CID 141417957) has the molecular formula C18H27NO9S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is ethyl (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbamoyl]-3-methylsulfonyl-3-(4-methylsulfonylphenyl)propanoate.
| Compound Name | ethyl (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbamoyl]-3-methylsulfonyl-3-(4-methylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 141417957 |
| Molecular Formula | C18H27NO9S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | ethyl (2S,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbamoyl]-3-methylsulfonyl-3-(4-methylsulfonylphenyl)propanoate |
| SMILES | CCOC(=O)[C@H](C(=O)NOC(C)(C)C)[C@@](O)(c1ccc(S(C)(=O)=O)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C18H27NO9S2/c1-7-27-16(21)14(15(20)19-28-17(2,3)4)18(22,30(6,25)26)12-8-10-13(11-9-12)29(5,23)24/h8-11,14,22H,7H2,1-6H3,(H,19,20)/t14-,18+/m0/s1 |
| InChIKey | FDXJHJMSYFJJOS-KBXCAEBGSA-N |
| XLogP | 0.31 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|