About 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide
3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide (PubChem CID 141418263) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide |
| PubChem CID | 141418263 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide |
| SMILES | NC(=O)c1cnc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H10N2O2/c10-8(12)7-4-6-2-1-3-13-9(6)11-5-7/h4-5H,1-3H2,(H2,10,12) |
| InChIKey | STZQGXPSRSXIOH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide?
The IUPAC name of 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide (CID 141418263) is 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide.
What is the SMILES notation for 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide?
The canonical SMILES for 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide is NC(=O)c1cnc2c(c1)CCCO2.
What is the InChIKey of 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide?
The InChIKey is STZQGXPSRSXIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c10-8(12)7-4-6-2-1-3-13-9(6)11-5-7/h4-5H,1-3H2,(H2,10,12).
What are the key properties of 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide?
3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide has a molecular weight of 178.19 g/mol, XLogP of 0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-pyrano[2,3-b]pyridine-6-carboxamide is sourced from PubChem (CID 141418263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).