About 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide
1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide (PubChem CID 141418270) has the molecular formula C8H14N2O3S
and a molecular weight of 218.28 g/mol. Its IUPAC name is 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide.
Molecular Properties
| Compound Name | 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide |
| PubChem CID | 141418270 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide |
| SMILES | NC(=O)C1CCS(=O)(=O)C12CCNC2 |
| InChI | InChI=1S/C8H14N2O3S/c9-7(11)6-1-4-14(12,13)8(6)2-3-10-5-8/h6,10H,1-5H2,(H2,9,11) |
| InChIKey | MWADLGPQNGFMQQ-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide?
The IUPAC name of 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide (CID 141418270) is 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide.
What is the SMILES notation for 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide?
The canonical SMILES for 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide is NC(=O)C1CCS(=O)(=O)C12CCNC2.
What is the InChIKey of 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide?
The InChIKey is MWADLGPQNGFMQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3S/c9-7(11)6-1-4-14(12,13)8(6)2-3-10-5-8/h6,10H,1-5H2,(H2,9,11).
What are the key properties of 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide?
1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide has a molecular weight of 218.28 g/mol, XLogP of -1.36, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-1λ6-thia-7-azaspiro[4.4]nonane-4-carboxamide is sourced from PubChem (CID 141418270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).