About magnesium;ditert-butylazanide;chloride
magnesium;ditert-butylazanide;chloride (PubChem CID 141418740) has the molecular formula C8H18ClMgN
and a molecular weight of 188.00 g/mol. Its IUPAC name is magnesium;ditert-butylazanide;chloride.
Molecular Properties
| Compound Name | magnesium;ditert-butylazanide;chloride |
| PubChem CID | 141418740 |
| Molecular Formula | C8H18ClMgN |
| Molecular Weight | 188.00 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | magnesium;ditert-butylazanide;chloride |
| SMILES | CC(C)(C)[N-]C(C)(C)C.[Cl-].[Mg+2] |
| InChI | InChI=1S/C8H18N.ClH.Mg/c1-7(2,3)9-8(4,5)6;;/h1-6H3;1H;/q-1;;+2/p-1 |
| InChIKey | BZVMIMPCIKIUJU-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.00 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze magnesium;ditert-butylazanide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;ditert-butylazanide;chloride?
The IUPAC name of magnesium;ditert-butylazanide;chloride (CID 141418740) is magnesium;ditert-butylazanide;chloride.
What is the SMILES notation for magnesium;ditert-butylazanide;chloride?
The canonical SMILES for magnesium;ditert-butylazanide;chloride is CC(C)(C)[N-]C(C)(C)C.[Cl-].[Mg+2].
What is the InChIKey of magnesium;ditert-butylazanide;chloride?
The InChIKey is BZVMIMPCIKIUJU-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18N.ClH.Mg/c1-7(2,3)9-8(4,5)6;;/h1-6H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;ditert-butylazanide;chloride?
magnesium;ditert-butylazanide;chloride has a molecular weight of 188.00 g/mol, XLogP of -0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;ditert-butylazanide;chloride is sourced from PubChem (CID 141418740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).