C22H14N8O2S3 — CID 141420234
2-[2-(1,2-oxazol-3-yl)-2-(1H-pyrrol-2-yl)-3-(1,2,4-thiadiazol-3-yl)-4-(1,2-thiazol-3-yl)-5-(1,3-thiazol-2-yl)-3H-pyrrol-1-yl]-1,3-oxazole (PubChem CID 141420234) has the molecular formula C22H14N8O2S3 and a molecular weight of 518.61 g/mol. Its IUPAC name is 2-[2-(1,2-oxazol-3-yl)-2-(1H-pyrrol-2-yl)-3-(1,2,4-thiadiazol-3-yl)-4-(1,2-thiazol-3-yl)-5-(1,3-thiazol-2-yl)-3H-pyrrol-1-yl]-1,3-oxazole.
| Compound Name | 2-[2-(1,2-oxazol-3-yl)-2-(1H-pyrrol-2-yl)-3-(1,2,4-thiadiazol-3-yl)-4-(1,2-thiazol-3-yl)-5-(1,3-thiazol-2-yl)-3H-pyrrol-1-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 141420234 |
| Molecular Formula | C22H14N8O2S3 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | 2-[2-(1,2-oxazol-3-yl)-2-(1H-pyrrol-2-yl)-3-(1,2,4-thiadiazol-3-yl)-4-(1,2-thiazol-3-yl)-5-(1,3-thiazol-2-yl)-3H-pyrrol-1-yl]-1,3-oxazole |
| SMILES | c1c[nH]c(C2(c3ccon3)C(c3ncsn3)C(c3ccsn3)=C(c3nccs3)N2c2ncco2)c1 |
| InChI | InChI=1S/C22H14N8O2S3/c1-2-14(23-5-1)22(15-3-8-32-27-15)17(19-26-12-35-29-19)16(13-4-10-34-28-13)18(20-24-7-11-33-20)30(22)21-25-6-9-31-21/h1-12,17,23H |
| InChIKey | HIBZVRHYKZZLOJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |