C24H26O7 — CID 141420240
[2,3-dihydroxy-2-(2-prop-2-enylphenyl)propanoyl] 2,3-dihydroxy-2-(2-prop-2-enylphenyl)propanoate (PubChem CID 141420240) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is [2,3-dihydroxy-2-(2-prop-2-enylphenyl)propanoyl] 2,3-dihydroxy-2-(2-prop-2-enylphenyl)propanoate.
| Compound Name | [2,3-dihydroxy-2-(2-prop-2-enylphenyl)propanoyl] 2,3-dihydroxy-2-(2-prop-2-enylphenyl)propanoate |
|---|---|
| PubChem CID | 141420240 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [2,3-dihydroxy-2-(2-prop-2-enylphenyl)propanoyl] 2,3-dihydroxy-2-(2-prop-2-enylphenyl)propanoate |
| SMILES | C=CCc1ccccc1C(O)(CO)C(=O)OC(=O)C(O)(CO)c1ccccc1CC=C |
| InChI | InChI=1S/C24H26O7/c1-3-9-17-11-5-7-13-19(17)23(29,15-25)21(27)31-22(28)24(30,16-26)20-14-8-6-12-18(20)10-4-2/h3-8,11-14,25-26,29-30H,1-2,9-10,15-16H2 |
| InChIKey | BUHJZFNZSXOVBW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|