About 5-ethenyloxolan-3-ol
5-ethenyloxolan-3-ol (PubChem CID 14142025) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is 5-ethenyloxolan-3-ol.
Molecular Properties
| Compound Name | 5-ethenyloxolan-3-ol |
| PubChem CID | 14142025 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 5-ethenyloxolan-3-ol |
| SMILES | C=CC1CC(O)CO1 |
| InChI | InChI=1S/C6H10O2/c1-2-6-3-5(7)4-8-6/h2,5-7H,1,3-4H2 |
| InChIKey | IPLBCSKZQGAJAW-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyloxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyloxolan-3-ol?
The IUPAC name of 5-ethenyloxolan-3-ol (CID 14142025) is 5-ethenyloxolan-3-ol.
What is the SMILES notation for 5-ethenyloxolan-3-ol?
The canonical SMILES for 5-ethenyloxolan-3-ol is C=CC1CC(O)CO1.
What is the InChIKey of 5-ethenyloxolan-3-ol?
The InChIKey is IPLBCSKZQGAJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2/c1-2-6-3-5(7)4-8-6/h2,5-7H,1,3-4H2.
What are the key properties of 5-ethenyloxolan-3-ol?
5-ethenyloxolan-3-ol has a molecular weight of 114.14 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyloxolan-3-ol is sourced from PubChem (CID 14142025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).