C20H27N3O — CID 141420513
7-(1-adamantylmethoxy)-6-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 141420513) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 7-(1-adamantylmethoxy)-6-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 7-(1-adamantylmethoxy)-6-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 141420513 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 7-(1-adamantylmethoxy)-6-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC(C)c1cn2cnnc2cc1OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H27N3O/c1-13(2)17-10-23-12-21-22-19(23)6-18(17)24-11-20-7-14-3-15(8-20)5-16(4-14)9-20/h6,10,12-16H,3-5,7-9,11H2,1-2H3 |
| InChIKey | UGCHXXWYNIWZFP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |