C15H15FN2O2 — CID 141420559
[(1S)-1-[5-(4-fluoro-3-methylphenyl)-2-pyridinyl]ethyl]carbamic acid (PubChem CID 141420559) has the molecular formula C15H15FN2O2 and a molecular weight of 274.30 g/mol. Its IUPAC name is [(1S)-1-[5-(4-fluoro-3-methylphenyl)-2-pyridinyl]ethyl]carbamic acid.
| Compound Name | [(1S)-1-[5-(4-fluoro-3-methylphenyl)-2-pyridinyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 141420559 |
| Molecular Formula | C15H15FN2O2 |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [(1S)-1-[5-(4-fluoro-3-methylphenyl)-2-pyridinyl]ethyl]carbamic acid |
| SMILES | Cc1cc(-c2ccc([C@H](C)NC(=O)O)nc2)ccc1F |
| InChI | InChI=1S/C15H15FN2O2/c1-9-7-11(3-5-13(9)16)12-4-6-14(17-8-12)10(2)18-15(19)20/h3-8,10,18H,1-2H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | VARHUQCZXNQPHK-JTQLQIEISA-N |
| XLogP | 3.52 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |