C14H17F2NO — CID 141420568
1-benzyl-4-[(2R)-1,1-difluoropropan-2-yl]pyrrolidin-2-one (PubChem CID 141420568) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is 1-benzyl-4-[(2R)-1,1-difluoropropan-2-yl]pyrrolidin-2-one.
| Compound Name | 1-benzyl-4-[(2R)-1,1-difluoropropan-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141420568 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-benzyl-4-[(2R)-1,1-difluoropropan-2-yl]pyrrolidin-2-one |
| SMILES | C[C@@H](C(F)F)C1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H17F2NO/c1-10(14(15)16)12-7-13(18)17(9-12)8-11-5-3-2-4-6-11/h2-6,10,12,14H,7-9H2,1H3/t10-,12?/m1/s1 |
| InChIKey | OZYSAAZQFTYTAK-RWANSRKNSA-N |
| XLogP | 2.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |