C18H33NO3 — CID 141420885
9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one (PubChem CID 141420885) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one.
| Compound Name | 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one |
|---|---|
| PubChem CID | 141420885 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one |
| SMILES | CC(C)C1COCCCCOC2CCC(CCC(=O)N1)CC2 |
| InChI | InChI=1S/C18H33NO3/c1-14(2)17-13-21-11-3-4-12-22-16-8-5-15(6-9-16)7-10-18(20)19-17/h14-17H,3-13H2,1-2H3,(H,19,20) |
| InChIKey | CGDSODSWCKEFFP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |