About 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one
9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one (PubChem CID 141420885) has the molecular formula C18H33NO3
and a molecular weight of 311.47 g/mol. Its IUPAC name is 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one.
Molecular Properties
| Compound Name | 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one |
| PubChem CID | 141420885 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one |
| SMILES | CC(C)C1COCCCCOC2CCC(CCC(=O)N1)CC2 |
| InChI | InChI=1S/C18H33NO3/c1-14(2)17-13-21-11-3-4-12-22-16-8-5-15(6-9-16)7-10-18(20)19-17/h14-17H,3-13H2,1-2H3,(H,19,20) |
| InChIKey | CGDSODSWCKEFFP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one?
The IUPAC name of 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one (CID 141420885) is 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one.
What is the SMILES notation for 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one?
The canonical SMILES for 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one is CC(C)C1COCCCCOC2CCC(CCC(=O)N1)CC2.
What is the InChIKey of 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one?
The InChIKey is CGDSODSWCKEFFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO3/c1-14(2)17-13-21-11-3-4-12-22-16-8-5-15(6-9-16)7-10-18(20)19-17/h14-17H,3-13H2,1-2H3,(H,19,20).
What are the key properties of 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one?
9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one has a molecular weight of 311.47 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-propan-2-yl-2,7-dioxa-10-azabicyclo[12.2.2]octadecan-11-one is sourced from PubChem (CID 141420885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).