About 2-quinolin-2-ylacetic acid;hydrate
2-quinolin-2-ylacetic acid;hydrate (PubChem CID 141421012) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-quinolin-2-ylacetic acid;hydrate.
Molecular Properties
| Compound Name | 2-quinolin-2-ylacetic acid;hydrate |
| PubChem CID | 141421012 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-quinolin-2-ylacetic acid;hydrate |
| SMILES | O.O=C(O)Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C11H9NO2.H2O/c13-11(14)7-9-6-5-8-3-1-2-4-10(8)12-9;/h1-6H,7H2,(H,13,14);1H2 |
| InChIKey | CKMLSYQJYIFEGV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-quinolin-2-ylacetic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-quinolin-2-ylacetic acid;hydrate?
The IUPAC name of 2-quinolin-2-ylacetic acid;hydrate (CID 141421012) is 2-quinolin-2-ylacetic acid;hydrate.
What is the SMILES notation for 2-quinolin-2-ylacetic acid;hydrate?
The canonical SMILES for 2-quinolin-2-ylacetic acid;hydrate is O.O=C(O)Cc1ccc2ccccc2n1.
What is the InChIKey of 2-quinolin-2-ylacetic acid;hydrate?
The InChIKey is CKMLSYQJYIFEGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2.H2O/c13-11(14)7-9-6-5-8-3-1-2-4-10(8)12-9;/h1-6H,7H2,(H,13,14);1H2.
What are the key properties of 2-quinolin-2-ylacetic acid;hydrate?
2-quinolin-2-ylacetic acid;hydrate has a molecular weight of 205.21 g/mol, XLogP of 1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinolin-2-ylacetic acid;hydrate is sourced from PubChem (CID 141421012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).