About ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine
ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine (PubChem CID 141421808) has the molecular formula C11H10FNO7
and a molecular weight of 287.20 g/mol. Its IUPAC name is ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine.
Molecular Properties
| Compound Name | ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine |
| PubChem CID | 141421808 |
| Molecular Formula | C11H10FNO7 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine |
| SMILES | CCOOC(=O)C(=O)F.O=c1oc1=O.c1ccncc1 |
| InChI | InChI=1S/C5H5N.C4H5FO4.C2O3/c1-2-4-6-5-3-1;1-2-8-9-4(7)3(5)6;3-1-2(4)5-1/h1-5H;2H2,1H3; |
| InChIKey | LYEWDJQGYJUESL-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine?
The IUPAC name of ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine (CID 141421808) is ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine.
What is the SMILES notation for ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine?
The canonical SMILES for ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine is CCOOC(=O)C(=O)F.O=c1oc1=O.c1ccncc1.
What is the InChIKey of ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine?
The InChIKey is LYEWDJQGYJUESL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.C4H5FO4.C2O3/c1-2-4-6-5-3-1;1-2-8-9-4(7)3(5)6;3-1-2(4)5-1/h1-5H;2H2,1H3;.
What are the key properties of ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine?
ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine has a molecular weight of 287.20 g/mol, XLogP of -0.07, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-fluoro-2-oxoethaneperoxoate;oxirane-2,3-dione;pyridine is sourced from PubChem (CID 141421808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).