About 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride
3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride (PubChem CID 141421934) has the molecular formula C10H12ClN5
and a molecular weight of 237.69 g/mol. Its IUPAC name is 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride |
| PubChem CID | 141421934 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride |
| SMILES | Cl.Nc1cnc2[nH]cc(N3CCC=N3)c2c1 |
| InChI | InChI=1S/C10H11N5.ClH/c11-7-4-8-9(15-3-1-2-14-15)6-13-10(8)12-5-7;/h2,4-6H,1,3,11H2,(H,12,13);1H |
| InChIKey | AEHMCNJABVPOSS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride?
The IUPAC name of 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride (CID 141421934) is 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride.
What is the SMILES notation for 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride?
The canonical SMILES for 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride is Cl.Nc1cnc2[nH]cc(N3CCC=N3)c2c1.
What is the InChIKey of 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride?
The InChIKey is AEHMCNJABVPOSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5.ClH/c11-7-4-8-9(15-3-1-2-14-15)6-13-10(8)12-5-7;/h2,4-6H,1,3,11H2,(H,12,13);1H.
What are the key properties of 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride?
3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride has a molecular weight of 237.69 g/mol, XLogP of 1.76, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydropyrazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-5-amine;hydrochloride is sourced from PubChem (CID 141421934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).