About 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine
8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine (PubChem CID 141422077) has the molecular formula C18H23N3O2
and a molecular weight of 313.40 g/mol. Its IUPAC name is 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine.
Molecular Properties
| Compound Name | 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine |
| PubChem CID | 141422077 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine |
| SMILES | CN1C2CCC1CC(=NOCC1CC(c3ccccc3)=NO1)C2 |
| InChI | InChI=1S/C18H23N3O2/c1-21-15-7-8-16(21)10-14(9-15)19-22-12-17-11-18(20-23-17)13-5-3-2-4-6-13/h2-6,15-17H,7-12H2,1H3 |
| InChIKey | ZKLXQRLWGVROAL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine?
The IUPAC name of 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine (CID 141422077) is 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine.
What is the SMILES notation for 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine?
The canonical SMILES for 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine is CN1C2CCC1CC(=NOCC1CC(c3ccccc3)=NO1)C2.
What is the InChIKey of 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine?
The InChIKey is ZKLXQRLWGVROAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O2/c1-21-15-7-8-16(21)10-14(9-15)19-22-12-17-11-18(20-23-17)13-5-3-2-4-6-13/h2-6,15-17H,7-12H2,1H3.
What are the key properties of 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine?
8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine has a molecular weight of 313.40 g/mol, XLogP of 2.81, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methoxy]-8-azabicyclo[3.2.1]octan-3-imine is sourced from PubChem (CID 141422077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).