About 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole
5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole (PubChem CID 141422223) has the molecular formula C21H26ClN3O2S
and a molecular weight of 419.98 g/mol. Its IUPAC name is 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole.
Molecular Properties
| Compound Name | 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole |
| PubChem CID | 141422223 |
| Molecular Formula | C21H26ClN3O2S |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole |
| SMILES | CCS(=O)(=O)N1CCC(c2cncc(N3Cc4ccc(Cl)cc4C3(C)C)c2)C1 |
| InChI | InChI=1S/C21H26ClN3O2S/c1-4-28(26,27)24-8-7-15(13-24)17-9-19(12-23-11-17)25-14-16-5-6-18(22)10-20(16)21(25,2)3/h5-6,9-12,15H,4,7-8,13-14H2,1-3H3 |
| InChIKey | BWWXTICVNAPMKV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole?
The IUPAC name of 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole (CID 141422223) is 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole.
What is the SMILES notation for 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole?
The canonical SMILES for 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole is CCS(=O)(=O)N1CCC(c2cncc(N3Cc4ccc(Cl)cc4C3(C)C)c2)C1.
What is the InChIKey of 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole?
The InChIKey is BWWXTICVNAPMKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26ClN3O2S/c1-4-28(26,27)24-8-7-15(13-24)17-9-19(12-23-11-17)25-14-16-5-6-18(22)10-20(16)21(25,2)3/h5-6,9-12,15H,4,7-8,13-14H2,1-3H3.
What are the key properties of 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole?
5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole has a molecular weight of 419.98 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[5-(1-ethylsulfonylpyrrolidin-3-yl)-3-pyridinyl]-3,3-dimethyl-1H-isoindole is sourced from PubChem (CID 141422223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).