About 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine
2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine (PubChem CID 141422887) has the molecular formula C10H24N4O
and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine |
| PubChem CID | 141422887 |
| Molecular Formula | C10H24N4O |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine |
| SMILES | NCCN1CCOCC1(CCN)CCN |
| InChI | InChI=1S/C10H24N4O/c11-3-1-10(2-4-12)9-15-8-7-14(10)6-5-13/h1-9,11-13H2 |
| InChIKey | CIMOLAIMKOOVHF-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 90.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine?
The IUPAC name of 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine (CID 141422887) is 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine.
What is the SMILES notation for 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine?
The canonical SMILES for 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine is NCCN1CCOCC1(CCN)CCN.
What is the InChIKey of 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine?
The InChIKey is CIMOLAIMKOOVHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N4O/c11-3-1-10(2-4-12)9-15-8-7-14(10)6-5-13/h1-9,11-13H2.
What are the key properties of 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine?
2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine has a molecular weight of 216.33 g/mol, XLogP of -1.29, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-bis(2-aminoethyl)morpholin-3-yl]ethanamine is sourced from PubChem (CID 141422887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).