About 10-bromophenoxazine
10-bromophenoxazine (PubChem CID 141423355) has the molecular formula C12H8BrNO
and a molecular weight of 262.11 g/mol. Its IUPAC name is 10-bromophenoxazine.
Molecular Properties
| Compound Name | 10-bromophenoxazine |
| PubChem CID | 141423355 |
| Molecular Formula | C12H8BrNO |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 10-bromophenoxazine |
| SMILES | BrN1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C12H8BrNO/c13-14-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14/h1-8H |
| InChIKey | SYCRGMUBTIBQOX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 10-bromophenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-bromophenoxazine?
The IUPAC name of 10-bromophenoxazine (CID 141423355) is 10-bromophenoxazine.
What is the SMILES notation for 10-bromophenoxazine?
The canonical SMILES for 10-bromophenoxazine is BrN1c2ccccc2Oc2ccccc21.
What is the InChIKey of 10-bromophenoxazine?
The InChIKey is SYCRGMUBTIBQOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrNO/c13-14-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14/h1-8H.
What are the key properties of 10-bromophenoxazine?
10-bromophenoxazine has a molecular weight of 262.11 g/mol, XLogP of 4.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-bromophenoxazine is sourced from PubChem (CID 141423355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).