C18H23F3N2O4 — CID 141423576
3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoic acid (PubChem CID 141423576) has the molecular formula C18H23F3N2O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is 3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoic acid.
| Compound Name | 3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoic acid |
|---|---|
| PubChem CID | 141423576 |
| Molecular Formula | C18H23F3N2O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-[4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoic acid |
| SMILES | CC(C)CN(CC(C)C)c1ccc(C(=CC(=O)O)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23F3N2O4/c1-11(2)9-22(10-12(3)4)15-6-5-13(7-16(15)23(26)27)14(8-17(24)25)18(19,20)21/h5-8,11-12H,9-10H2,1-4H3,(H,24,25) |
| InChIKey | VQEPOKJKQCLERQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|