About 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol
9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol (PubChem CID 141424062) has the molecular formula C19H14F2N2OS
and a molecular weight of 356.40 g/mol. Its IUPAC name is 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol.
Molecular Properties
| Compound Name | 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol |
| PubChem CID | 141424062 |
| Molecular Formula | C19H14F2N2OS |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol |
| SMILES | NCCc1c(F)cc(-c2c(O)ccc3ncc4sccc4c23)cc1F |
| InChI | InChI=1S/C19H14F2N2OS/c20-13-7-10(8-14(21)11(13)3-5-22)18-16(24)2-1-15-19(18)12-4-6-25-17(12)9-23-15/h1-2,4,6-9,24H,3,5,22H2 |
| InChIKey | NTLWIWDOIOWBFP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol?
The IUPAC name of 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol (CID 141424062) is 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol.
What is the SMILES notation for 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol?
The canonical SMILES for 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol is NCCc1c(F)cc(-c2c(O)ccc3ncc4sccc4c23)cc1F.
What is the InChIKey of 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol?
The InChIKey is NTLWIWDOIOWBFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2N2OS/c20-13-7-10(8-14(21)11(13)3-5-22)18-16(24)2-1-15-19(18)12-4-6-25-17(12)9-23-15/h1-2,4,6-9,24H,3,5,22H2.
What are the key properties of 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol?
9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol has a molecular weight of 356.40 g/mol, XLogP of 4.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-(2-aminoethyl)-3,5-difluorophenyl]thieno[2,3-c]quinolin-8-ol is sourced from PubChem (CID 141424062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).