About 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol
9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol (PubChem CID 141424066) has the molecular formula C20H17FN2OS
and a molecular weight of 352.43 g/mol. Its IUPAC name is 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol.
Molecular Properties
| Compound Name | 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol |
| PubChem CID | 141424066 |
| Molecular Formula | C20H17FN2OS |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol |
| SMILES | CNCCc1ccc(-c2c(O)ccc3ncc4sccc4c23)cc1F |
| InChI | InChI=1S/C20H17FN2OS/c1-22-8-6-12-2-3-13(10-15(12)21)19-17(24)5-4-16-20(19)14-7-9-25-18(14)11-23-16/h2-5,7,9-11,22,24H,6,8H2,1H3 |
| InChIKey | ZNCXVJCIBPQLDF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol?
The IUPAC name of 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol (CID 141424066) is 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol.
What is the SMILES notation for 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol?
The canonical SMILES for 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol is CNCCc1ccc(-c2c(O)ccc3ncc4sccc4c23)cc1F.
What is the InChIKey of 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol?
The InChIKey is ZNCXVJCIBPQLDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17FN2OS/c1-22-8-6-12-2-3-13(10-15(12)21)19-17(24)5-4-16-20(19)14-7-9-25-18(14)11-23-16/h2-5,7,9-11,22,24H,6,8H2,1H3.
What are the key properties of 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol?
9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol has a molecular weight of 352.43 g/mol, XLogP of 4.72, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[3-fluoro-4-[2-(methylamino)ethyl]phenyl]thieno[2,3-c]quinolin-8-ol is sourced from PubChem (CID 141424066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).