About 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol
9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol (PubChem CID 141424068) has the molecular formula C21H18N2OS
and a molecular weight of 346.46 g/mol. Its IUPAC name is 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol.
Molecular Properties
| Compound Name | 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol |
| PubChem CID | 141424068 |
| Molecular Formula | C21H18N2OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol |
| SMILES | C=Cc1cc(O)c(-c2ccc([C@@H](C)N)cc2)c2c1ncc1sccc12 |
| InChI | InChI=1S/C21H18N2OS/c1-3-13-10-17(24)19(15-6-4-14(5-7-15)12(2)22)20-16-8-9-25-18(16)11-23-21(13)20/h3-12,24H,1,22H2,2H3/t12-/m1/s1 |
| InChIKey | NSPLZDKJQBTDHM-GFCCVEGCSA-N |
| XLogP | 5.48 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol?
The IUPAC name of 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol (CID 141424068) is 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol.
What is the SMILES notation for 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol?
The canonical SMILES for 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol is C=Cc1cc(O)c(-c2ccc([C@@H](C)N)cc2)c2c1ncc1sccc12.
What is the InChIKey of 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol?
The InChIKey is NSPLZDKJQBTDHM-GFCCVEGCSA-N. The full InChI is InChI=1S/C21H18N2OS/c1-3-13-10-17(24)19(15-6-4-14(5-7-15)12(2)22)20-16-8-9-25-18(16)11-23-21(13)20/h3-12,24H,1,22H2,2H3/t12-/m1/s1.
What are the key properties of 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol?
9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol has a molecular weight of 346.46 g/mol, XLogP of 5.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-[(1R)-1-aminoethyl]phenyl]-6-ethenylthieno[2,3-c]quinolin-8-ol is sourced from PubChem (CID 141424068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).