C17H16N4OS — CID 141424185
2-[4-(8-methoxythieno[2,3-c]quinolin-9-yl)pyrazol-1-yl]ethanamine (PubChem CID 141424185) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-[4-(8-methoxythieno[2,3-c]quinolin-9-yl)pyrazol-1-yl]ethanamine.
| Compound Name | 2-[4-(8-methoxythieno[2,3-c]quinolin-9-yl)pyrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 141424185 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-[4-(8-methoxythieno[2,3-c]quinolin-9-yl)pyrazol-1-yl]ethanamine |
| SMILES | COc1ccc2ncc3sccc3c2c1-c1cnn(CCN)c1 |
| InChI | InChI=1S/C17H16N4OS/c1-22-14-3-2-13-17(12-4-7-23-15(12)9-19-13)16(14)11-8-20-21(10-11)6-5-18/h2-4,7-10H,5-6,18H2,1H3 |
| InChIKey | JIZRDFIORVHNEO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |