About 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol
9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol (PubChem CID 141424247) has the molecular formula C21H19FN2OS
and a molecular weight of 366.46 g/mol. Its IUPAC name is 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol.
Molecular Properties
| Compound Name | 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol |
| PubChem CID | 141424247 |
| Molecular Formula | C21H19FN2OS |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol |
| SMILES | CC(C)(CN)c1ccc(-c2c(O)ccc3ncc4sccc4c23)cc1F |
| InChI | InChI=1S/C21H19FN2OS/c1-21(2,11-23)14-4-3-12(9-15(14)22)19-17(25)6-5-16-20(19)13-7-8-26-18(13)10-24-16/h3-10,25H,11,23H2,1-2H3 |
| InChIKey | GXWKZDYMXTWREL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol?
The IUPAC name of 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol (CID 141424247) is 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol.
What is the SMILES notation for 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol?
The canonical SMILES for 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol is CC(C)(CN)c1ccc(-c2c(O)ccc3ncc4sccc4c23)cc1F.
What is the InChIKey of 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol?
The InChIKey is GXWKZDYMXTWREL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN2OS/c1-21(2,11-23)14-4-3-12(9-15(14)22)19-17(25)6-5-16-20(19)13-7-8-26-18(13)10-24-16/h3-10,25H,11,23H2,1-2H3.
What are the key properties of 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol?
9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol has a molecular weight of 366.46 g/mol, XLogP of 5.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-(1-amino-2-methylpropan-2-yl)-3-fluorophenyl]thieno[2,3-c]quinolin-8-ol is sourced from PubChem (CID 141424247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).