About 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one
5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one (PubChem CID 141424295) has the molecular formula C21H18ClNO2S
and a molecular weight of 383.90 g/mol. Its IUPAC name is 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one.
Molecular Properties
| Compound Name | 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one |
| PubChem CID | 141424295 |
| Molecular Formula | C21H18ClNO2S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one |
| SMILES | COc1ccc2c(c1-c1ccccc1)c1ccsc1c(=O)n2C(C)CCl |
| InChI | InChI=1S/C21H18ClNO2S/c1-13(12-22)23-16-8-9-17(25-2)18(14-6-4-3-5-7-14)19(16)15-10-11-26-20(15)21(23)24/h3-11,13H,12H2,1-2H3 |
| InChIKey | SQGKFRKRKRKEOY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one?
The IUPAC name of 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one (CID 141424295) is 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one.
What is the SMILES notation for 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one?
The canonical SMILES for 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one is COc1ccc2c(c1-c1ccccc1)c1ccsc1c(=O)n2C(C)CCl.
What is the InChIKey of 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one?
The InChIKey is SQGKFRKRKRKEOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClNO2S/c1-13(12-22)23-16-8-9-17(25-2)18(14-6-4-3-5-7-14)19(16)15-10-11-26-20(15)21(23)24/h3-11,13H,12H2,1-2H3.
What are the key properties of 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one?
5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one has a molecular weight of 383.90 g/mol, XLogP of 5.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-chloropropan-2-yl)-8-methoxy-9-phenylthieno[2,3-c]quinolin-4-one is sourced from PubChem (CID 141424295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).