C28H42O4 — CID 141424711
(Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-(3-oxodecyl)-5-phenylcyclopentyl]hept-5-enoic acid (PubChem CID 141424711) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-(3-oxodecyl)-5-phenylcyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-(3-oxodecyl)-5-phenylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 141424711 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-(3-oxodecyl)-5-phenylcyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@H](C/C=C\CCCC(=O)O)[C@@H](c2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C28H42O4/c1-2-3-4-5-11-16-23(29)19-20-25-24(17-12-6-7-13-18-28(31)32)26(21-27(25)30)22-14-9-8-10-15-22/h6,8-10,12,14-15,24-27,30H,2-5,7,11,13,16-21H2,1H3,(H,31,32)/b12-6-/t24-,25+,26+,27+/m0/s1 |
| InChIKey | TYCDJYOQGRJDQD-FCMIQLMASA-N |
| XLogP | 6.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|