About 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine
3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine (PubChem CID 141424891) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine.
Molecular Properties
| Compound Name | 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine |
| PubChem CID | 141424891 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine |
| SMILES | CNC1C=C(C2C=CC=C2)CCC1OC |
| InChI | InChI=1S/C13H19NO/c1-14-12-9-11(7-8-13(12)15-2)10-5-3-4-6-10/h3-6,9-10,12-14H,7-8H2,1-2H3 |
| InChIKey | YMOUMAZQCISUAC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine?
The IUPAC name of 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine (CID 141424891) is 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine.
What is the SMILES notation for 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine?
The canonical SMILES for 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine is CNC1C=C(C2C=CC=C2)CCC1OC.
What is the InChIKey of 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine?
The InChIKey is YMOUMAZQCISUAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-14-12-9-11(7-8-13(12)15-2)10-5-3-4-6-10/h3-6,9-10,12-14H,7-8H2,1-2H3.
What are the key properties of 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine?
3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine has a molecular weight of 205.30 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopenta-2,4-dien-1-yl-6-methoxy-N-methylcyclohex-2-en-1-amine is sourced from PubChem (CID 141424891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).