C11H17N3O — CID 141424908
3-imidazol-1-yl-N,6,6-trimethyl-2,5-dihydropyran-5-amine (PubChem CID 141424908) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-imidazol-1-yl-N,6,6-trimethyl-2,5-dihydropyran-5-amine.
| Compound Name | 3-imidazol-1-yl-N,6,6-trimethyl-2,5-dihydropyran-5-amine |
|---|---|
| PubChem CID | 141424908 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-imidazol-1-yl-N,6,6-trimethyl-2,5-dihydropyran-5-amine |
| SMILES | CNC1C=C(n2ccnc2)COC1(C)C |
| InChI | InChI=1S/C11H17N3O/c1-11(2)10(12-3)6-9(7-15-11)14-5-4-13-8-14/h4-6,8,10,12H,7H2,1-3H3 |
| InChIKey | KKZAORHJVWZPIF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |