C13H19NO6 — CID 14142530
(2R,3R)-2,3-dihydroxybutanedioic acid;(2S)-1-phenylpropan-2-amine (PubChem CID 14142530) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanedioic acid;(2S)-1-phenylpropan-2-amine.
| Compound Name | (2R,3R)-2,3-dihydroxybutanedioic acid;(2S)-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 14142530 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;(2S)-1-phenylpropan-2-amine |
| SMILES | C[C@H](N)Cc1ccccc1.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C9H13N.C4H6O6/c1-8(10)7-9-5-3-2-4-6-9;5-1(3(7)8)2(6)4(9)10/h2-6,8H,7,10H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t8-;1-,2-/m01/s1 |
| InChIKey | KHIBJQODXRPUJC-YIDNRZKSSA-N |
| XLogP | -0.55 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |