C19H18N4O3 — CID 141425615
4-nitro-1-(oxan-2-yl)-3-(2-pyridin-2-ylethenyl)indazole (PubChem CID 141425615) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 4-nitro-1-(oxan-2-yl)-3-(2-pyridin-2-ylethenyl)indazole.
| Compound Name | 4-nitro-1-(oxan-2-yl)-3-(2-pyridin-2-ylethenyl)indazole |
|---|---|
| PubChem CID | 141425615 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-nitro-1-(oxan-2-yl)-3-(2-pyridin-2-ylethenyl)indazole |
| SMILES | O=[N+]([O-])c1cccc2c1c(C=Cc1ccccn1)nn2C1CCCCO1 |
| InChI | InChI=1S/C19H18N4O3/c24-23(25)17-8-5-7-16-19(17)15(11-10-14-6-1-3-12-20-14)21-22(16)18-9-2-4-13-26-18/h1,3,5-8,10-12,18H,2,4,9,13H2 |
| InChIKey | JCTWTVIJAYBQOD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|