About methylurea;hydrate
methylurea;hydrate (PubChem CID 141425619) has the molecular formula C2H8N2O2
and a molecular weight of 92.10 g/mol. Its IUPAC name is methylurea;hydrate.
Molecular Properties
| Compound Name | methylurea;hydrate |
| PubChem CID | 141425619 |
| Molecular Formula | C2H8N2O2 |
| Molecular Weight | 92.10 g/mol |
| Exact Mass | 92.06 |
| IUPAC Name | methylurea;hydrate |
| SMILES | CNC(N)=O.O |
| InChI | InChI=1S/C2H6N2O.H2O/c1-4-2(3)5;/h1H3,(H3,3,4,5);1H2 |
| InChIKey | QXXREGVBELTJEM-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.10 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methylurea;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylurea;hydrate?
The IUPAC name of methylurea;hydrate (CID 141425619) is methylurea;hydrate.
What is the SMILES notation for methylurea;hydrate?
The canonical SMILES for methylurea;hydrate is CNC(N)=O.O.
What is the InChIKey of methylurea;hydrate?
The InChIKey is QXXREGVBELTJEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O.H2O/c1-4-2(3)5;/h1H3,(H3,3,4,5);1H2.
What are the key properties of methylurea;hydrate?
methylurea;hydrate has a molecular weight of 92.10 g/mol, XLogP of -1.54, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylurea;hydrate is sourced from PubChem (CID 141425619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).