About 3-(cyclohexylamino)-1,1-dimethylthiourea
3-(cyclohexylamino)-1,1-dimethylthiourea (PubChem CID 141426043) has the molecular formula C9H19N3S
and a molecular weight of 201.34 g/mol. Its IUPAC name is 3-(cyclohexylamino)-1,1-dimethylthiourea.
Molecular Properties
| Compound Name | 3-(cyclohexylamino)-1,1-dimethylthiourea |
| PubChem CID | 141426043 |
| Molecular Formula | C9H19N3S |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3-(cyclohexylamino)-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)NNC1CCCCC1 |
| InChI | InChI=1S/C9H19N3S/c1-12(2)9(13)11-10-8-6-4-3-5-7-8/h8,10H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | HFHLLMNMHDUSHO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(cyclohexylamino)-1,1-dimethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexylamino)-1,1-dimethylthiourea?
The IUPAC name of 3-(cyclohexylamino)-1,1-dimethylthiourea (CID 141426043) is 3-(cyclohexylamino)-1,1-dimethylthiourea.
What is the SMILES notation for 3-(cyclohexylamino)-1,1-dimethylthiourea?
The canonical SMILES for 3-(cyclohexylamino)-1,1-dimethylthiourea is CN(C)C(=S)NNC1CCCCC1.
What is the InChIKey of 3-(cyclohexylamino)-1,1-dimethylthiourea?
The InChIKey is HFHLLMNMHDUSHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3S/c1-12(2)9(13)11-10-8-6-4-3-5-7-8/h8,10H,3-7H2,1-2H3,(H,11,13).
What are the key properties of 3-(cyclohexylamino)-1,1-dimethylthiourea?
3-(cyclohexylamino)-1,1-dimethylthiourea has a molecular weight of 201.34 g/mol, XLogP of 1.26, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexylamino)-1,1-dimethylthiourea is sourced from PubChem (CID 141426043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).