About 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one
1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one (PubChem CID 141426571) has the molecular formula C11H12ClF2NO
and a molecular weight of 247.67 g/mol. Its IUPAC name is 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one.
Molecular Properties
| Compound Name | 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one |
| PubChem CID | 141426571 |
| Molecular Formula | C11H12ClF2NO |
| Molecular Weight | 247.67 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one |
| SMILES | O=C1N(CCCCl)C2=CC=CCC2C1(F)F |
| InChI | InChI=1S/C11H12ClF2NO/c12-6-3-7-15-9-5-2-1-4-8(9)11(13,14)10(15)16/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | OGQCCKOLKARMLC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one?
The IUPAC name of 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one (CID 141426571) is 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one.
What is the SMILES notation for 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one?
The canonical SMILES for 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one is O=C1N(CCCCl)C2=CC=CCC2C1(F)F.
What is the InChIKey of 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one?
The InChIKey is OGQCCKOLKARMLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClF2NO/c12-6-3-7-15-9-5-2-1-4-8(9)11(13,14)10(15)16/h1-2,5,8H,3-4,6-7H2.
What are the key properties of 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one?
1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one has a molecular weight of 247.67 g/mol, XLogP of 2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloropropyl)-3,3-difluoro-3a,4-dihydroindol-2-one is sourced from PubChem (CID 141426571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).