C18H21NO2 — CID 141427034
(5R)-5-[(E,3S)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one (PubChem CID 141427034) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (5R)-5-[(E,3S)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(E,3S)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141427034 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (5R)-5-[(E,3S)-3-hydroxy-4-methyl-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one |
| SMILES | CC(CC#Cc1ccccc1)[C@H](O)/C=C/[C@H]1CCC(=O)N1 |
| InChI | InChI=1S/C18H21NO2/c1-14(6-5-9-15-7-3-2-4-8-15)17(20)12-10-16-11-13-18(21)19-16/h2-4,7-8,10,12,14,16-17,20H,6,11,13H2,1H3,(H,19,21)/b12-10+/t14?,16-,17+/m0/s1 |
| InChIKey | SBVRUIQHHQGGOM-XJAWNIGNSA-N |
| XLogP | 2.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|