C17H19NO2 — CID 141427044
(5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one (PubChem CID 141427044) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141427044 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](/C=C/[C@H](O)CCC#Cc2ccccc2)N1 |
| InChI | InChI=1S/C17H19NO2/c19-16(12-10-15-11-13-17(20)18-15)9-5-4-8-14-6-2-1-3-7-14/h1-3,6-7,10,12,15-16,19H,5,9,11,13H2,(H,18,20)/b12-10+/t15-,16+/m0/s1 |
| InChIKey | VUZLVAYHWHXMQM-AOOXPWSASA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|