About (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one
(5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one (PubChem CID 141427044) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one |
| PubChem CID | 141427044 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](/C=C/[C@H](O)CCC#Cc2ccccc2)N1 |
| InChI | InChI=1S/C17H19NO2/c19-16(12-10-15-11-13-17(20)18-15)9-5-4-8-14-6-2-1-3-7-14/h1-3,6-7,10,12,15-16,19H,5,9,11,13H2,(H,18,20)/b12-10+/t15-,16+/m0/s1 |
| InChIKey | VUZLVAYHWHXMQM-AOOXPWSASA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one?
The IUPAC name of (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one (CID 141427044) is (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one.
What is the SMILES notation for (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one?
The canonical SMILES for (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one is O=C1CC[C@H](/C=C/[C@H](O)CCC#Cc2ccccc2)N1.
What is the InChIKey of (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one?
The InChIKey is VUZLVAYHWHXMQM-AOOXPWSASA-N. The full InChI is InChI=1S/C17H19NO2/c19-16(12-10-15-11-13-17(20)18-15)9-5-4-8-14-6-2-1-3-7-14/h1-3,6-7,10,12,15-16,19H,5,9,11,13H2,(H,18,20)/b12-10+/t15-,16+/m0/s1.
What are the key properties of (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one?
(5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one has a molecular weight of 269.34 g/mol, XLogP of 2.01, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[(E,3R)-3-hydroxy-7-phenylhept-1-en-6-ynyl]pyrrolidin-2-one is sourced from PubChem (CID 141427044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).