About 2-(1,3-oxazol-2-ylmethyl)guanidine
2-(1,3-oxazol-2-ylmethyl)guanidine (PubChem CID 141427084) has the molecular formula C5H8N4O
and a molecular weight of 140.15 g/mol. Its IUPAC name is 2-(1,3-oxazol-2-ylmethyl)guanidine.
Molecular Properties
| Compound Name | 2-(1,3-oxazol-2-ylmethyl)guanidine |
| PubChem CID | 141427084 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 2-(1,3-oxazol-2-ylmethyl)guanidine |
| SMILES | NC(N)=NCc1ncco1 |
| InChI | InChI=1S/C5H8N4O/c6-5(7)9-3-4-8-1-2-10-4/h1-2H,3H2,(H4,6,7,9) |
| InChIKey | JEHBXQUQMNQHAB-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-oxazol-2-ylmethyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-oxazol-2-ylmethyl)guanidine?
The IUPAC name of 2-(1,3-oxazol-2-ylmethyl)guanidine (CID 141427084) is 2-(1,3-oxazol-2-ylmethyl)guanidine.
What is the SMILES notation for 2-(1,3-oxazol-2-ylmethyl)guanidine?
The canonical SMILES for 2-(1,3-oxazol-2-ylmethyl)guanidine is NC(N)=NCc1ncco1.
What is the InChIKey of 2-(1,3-oxazol-2-ylmethyl)guanidine?
The InChIKey is JEHBXQUQMNQHAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O/c6-5(7)9-3-4-8-1-2-10-4/h1-2H,3H2,(H4,6,7,9).
What are the key properties of 2-(1,3-oxazol-2-ylmethyl)guanidine?
2-(1,3-oxazol-2-ylmethyl)guanidine has a molecular weight of 140.15 g/mol, XLogP of -0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-oxazol-2-ylmethyl)guanidine is sourced from PubChem (CID 141427084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).