About N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide
N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide (PubChem CID 141427152) has the molecular formula C12H16F3N3O2
and a molecular weight of 291.27 g/mol. Its IUPAC name is N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide |
| PubChem CID | 141427152 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide |
| SMILES | NCCCCN(C(=O)C(F)(F)F)c1ccc(N)c(O)c1 |
| InChI | InChI=1S/C12H16F3N3O2/c13-12(14,15)11(20)18(6-2-1-5-16)8-3-4-9(17)10(19)7-8/h3-4,7,19H,1-2,5-6,16-17H2 |
| InChIKey | FZDAYXMUFREYHA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide?
The IUPAC name of N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide (CID 141427152) is N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide?
The canonical SMILES for N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide is NCCCCN(C(=O)C(F)(F)F)c1ccc(N)c(O)c1.
What is the InChIKey of N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide?
The InChIKey is FZDAYXMUFREYHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3N3O2/c13-12(14,15)11(20)18(6-2-1-5-16)8-3-4-9(17)10(19)7-8/h3-4,7,19H,1-2,5-6,16-17H2.
What are the key properties of N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide?
N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide has a molecular weight of 291.27 g/mol, XLogP of 1.61, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminobutyl)-N-(4-amino-3-hydroxyphenyl)-2,2,2-trifluoroacetamide is sourced from PubChem (CID 141427152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).