About 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole
2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole (PubChem CID 141427364) has the molecular formula C11H19NS
and a molecular weight of 197.35 g/mol. Its IUPAC name is 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole |
| PubChem CID | 141427364 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole |
| SMILES | CC(C)=C(C)CCC1(C)NC=CS1 |
| InChI | InChI=1S/C11H19NS/c1-9(2)10(3)5-6-11(4)12-7-8-13-11/h7-8,12H,5-6H2,1-4H3 |
| InChIKey | UKIWGULVDZFVJW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole?
The IUPAC name of 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole (CID 141427364) is 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole.
What is the SMILES notation for 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole?
The canonical SMILES for 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole is CC(C)=C(C)CCC1(C)NC=CS1.
What is the InChIKey of 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole?
The InChIKey is UKIWGULVDZFVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NS/c1-9(2)10(3)5-6-11(4)12-7-8-13-11/h7-8,12H,5-6H2,1-4H3.
What are the key properties of 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole?
2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole has a molecular weight of 197.35 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylpent-3-enyl)-2-methyl-3H-1,3-thiazole is sourced from PubChem (CID 141427364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).