About 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene
5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene (PubChem CID 141427748) has the molecular formula C9H5F5
and a molecular weight of 208.13 g/mol. Its IUPAC name is 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene |
| PubChem CID | 141427748 |
| Molecular Formula | C9H5F5 |
| Molecular Weight | 208.13 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene |
| SMILES | C=Cc1cc(F)c(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C9H5F5/c1-2-5-3-6(10)8(7(11)4-5)9(12,13)14/h2-4H,1H2 |
| InChIKey | PZZASSBIRVFMKO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.13 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene?
The IUPAC name of 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene (CID 141427748) is 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene.
What is the SMILES notation for 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene?
The canonical SMILES for 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene is C=Cc1cc(F)c(C(F)(F)F)c(F)c1.
What is the InChIKey of 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene?
The InChIKey is PZZASSBIRVFMKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F5/c1-2-5-3-6(10)8(7(11)4-5)9(12,13)14/h2-4H,1H2.
What are the key properties of 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene?
5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene has a molecular weight of 208.13 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-1,3-difluoro-2-(trifluoromethyl)benzene is sourced from PubChem (CID 141427748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).