About hept-6-en-1-yn-3-one
hept-6-en-1-yn-3-one (PubChem CID 141427795) has the molecular formula C7H8O
and a molecular weight of 108.14 g/mol. Its IUPAC name is hept-6-en-1-yn-3-one.
Molecular Properties
| Compound Name | hept-6-en-1-yn-3-one |
| PubChem CID | 141427795 |
| Molecular Formula | C7H8O |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.06 |
| IUPAC Name | hept-6-en-1-yn-3-one |
| SMILES | C#CC(=O)CCC=C |
| InChI | InChI=1S/C7H8O/c1-3-5-6-7(8)4-2/h2-3H,1,5-6H2 |
| InChIKey | FHLOJCCLLKFFTD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hept-6-en-1-yn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-en-1-yn-3-one?
The IUPAC name of hept-6-en-1-yn-3-one (CID 141427795) is hept-6-en-1-yn-3-one.
What is the SMILES notation for hept-6-en-1-yn-3-one?
The canonical SMILES for hept-6-en-1-yn-3-one is C#CC(=O)CCC=C.
What is the InChIKey of hept-6-en-1-yn-3-one?
The InChIKey is FHLOJCCLLKFFTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O/c1-3-5-6-7(8)4-2/h2-3H,1,5-6H2.
What are the key properties of hept-6-en-1-yn-3-one?
hept-6-en-1-yn-3-one has a molecular weight of 108.14 g/mol, XLogP of 1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-en-1-yn-3-one is sourced from PubChem (CID 141427795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).