About 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine
1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine (PubChem CID 141428111) has the molecular formula C16H22ClNO
and a molecular weight of 279.81 g/mol. Its IUPAC name is 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine |
| PubChem CID | 141428111 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine |
| SMILES | Clc1cccc(OC[C@@H]2CC[C@@H]2CN2CCCC2)c1 |
| InChI | InChI=1S/C16H22ClNO/c17-15-4-3-5-16(10-15)19-12-14-7-6-13(14)11-18-8-1-2-9-18/h3-5,10,13-14H,1-2,6-9,11-12H2/t13-,14+/m1/s1 |
| InChIKey | HJSBQIKHAGBTNG-KGLIPLIRSA-N |
| XLogP | 3.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine?
The IUPAC name of 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine (CID 141428111) is 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine.
What is the SMILES notation for 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine?
The canonical SMILES for 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine is Clc1cccc(OC[C@@H]2CC[C@@H]2CN2CCCC2)c1.
What is the InChIKey of 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine?
The InChIKey is HJSBQIKHAGBTNG-KGLIPLIRSA-N. The full InChI is InChI=1S/C16H22ClNO/c17-15-4-3-5-16(10-15)19-12-14-7-6-13(14)11-18-8-1-2-9-18/h3-5,10,13-14H,1-2,6-9,11-12H2/t13-,14+/m1/s1.
What are the key properties of 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine?
1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine has a molecular weight of 279.81 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1S,2R)-2-[(3-chlorophenoxy)methyl]cyclobutyl]methyl]pyrrolidine is sourced from PubChem (CID 141428111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).