About 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile
3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 141428930) has the molecular formula C19H11F3N2OS
and a molecular weight of 372.37 g/mol. Its IUPAC name is 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile |
| PubChem CID | 141428930 |
| Molecular Formula | C19H11F3N2OS |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | N#CC(=C(O)c1ccccc1C(F)(F)F)c1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C19H11F3N2OS/c20-19(21,22)15-9-5-4-8-13(15)17(25)14(10-23)16-11-24-18(26-16)12-6-2-1-3-7-12/h1-9,11,25H |
| InChIKey | STBYHXVWAGZWTD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile?
The IUPAC name of 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile (CID 141428930) is 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile.
What is the SMILES notation for 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile?
The canonical SMILES for 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile is N#CC(=C(O)c1ccccc1C(F)(F)F)c1cnc(-c2ccccc2)s1.
What is the InChIKey of 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile?
The InChIKey is STBYHXVWAGZWTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11F3N2OS/c20-19(21,22)15-9-5-4-8-13(15)17(25)14(10-23)16-11-24-18(26-16)12-6-2-1-3-7-12/h1-9,11,25H.
What are the key properties of 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile?
3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile has a molecular weight of 372.37 g/mol, XLogP of 5.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-(2-phenyl-1,3-thiazol-5-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile is sourced from PubChem (CID 141428930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).