C17H18N4O — CID 141430289
2-(3-imidazol-1-yl-4-methylphenyl)-5-[(2S)-oxolan-2-yl]-1H-imidazole (PubChem CID 141430289) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-(3-imidazol-1-yl-4-methylphenyl)-5-[(2S)-oxolan-2-yl]-1H-imidazole.
| Compound Name | 2-(3-imidazol-1-yl-4-methylphenyl)-5-[(2S)-oxolan-2-yl]-1H-imidazole |
|---|---|
| PubChem CID | 141430289 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-(3-imidazol-1-yl-4-methylphenyl)-5-[(2S)-oxolan-2-yl]-1H-imidazole |
| SMILES | Cc1ccc(-c2ncc([C@@H]3CCCO3)[nH]2)cc1-n1ccnc1 |
| InChI | InChI=1S/C17H18N4O/c1-12-4-5-13(9-15(12)21-7-6-18-11-21)17-19-10-14(20-17)16-3-2-8-22-16/h4-7,9-11,16H,2-3,8H2,1H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | FJLNQICLSYZEOK-INIZCTEOSA-N |
| XLogP | 3.42 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |