C15H15F4N3 — CID 141430319
3-(4-methylphenyl)-5-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]-1H-pyrazole (PubChem CID 141430319) has the molecular formula C15H15F4N3 and a molecular weight of 313.30 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]-1H-pyrazole.
| Compound Name | 3-(4-methylphenyl)-5-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]-1H-pyrazole |
|---|---|
| PubChem CID | 141430319 |
| Molecular Formula | C15H15F4N3 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-(4-methylphenyl)-5-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]-1H-pyrazole |
| SMILES | Cc1ccc(-c2cc(CN3CC(F)(F)C(F)(F)C3)[nH]n2)cc1 |
| InChI | InChI=1S/C15H15F4N3/c1-10-2-4-11(5-3-10)13-6-12(20-21-13)7-22-8-14(16,17)15(18,19)9-22/h2-6H,7-9H2,1H3,(H,20,21) |
| InChIKey | PFCIARUPDHJKDH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|