C18H26N4 — CID 141430975
N-hexan-2-yl-1-quinazolin-4-ylpyrrolidin-3-amine (PubChem CID 141430975) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is N-hexan-2-yl-1-quinazolin-4-ylpyrrolidin-3-amine.
| Compound Name | N-hexan-2-yl-1-quinazolin-4-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 141430975 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N-hexan-2-yl-1-quinazolin-4-ylpyrrolidin-3-amine |
| SMILES | CCCCC(C)NC1CCN(c2ncnc3ccccc23)C1 |
| InChI | InChI=1S/C18H26N4/c1-3-4-7-14(2)21-15-10-11-22(12-15)18-16-8-5-6-9-17(16)19-13-20-18/h5-6,8-9,13-15,21H,3-4,7,10-12H2,1-2H3 |
| InChIKey | XVSSQIGWYUFJFN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |