About 1,3,8-trimethyl-2H-purine
1,3,8-trimethyl-2H-purine (PubChem CID 141431036) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,3,8-trimethyl-2H-purine.
Molecular Properties
| Compound Name | 1,3,8-trimethyl-2H-purine |
| PubChem CID | 141431036 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1,3,8-trimethyl-2H-purine |
| SMILES | CC1=NC2=CN(C)CN(C)C2=N1 |
| InChI | InChI=1S/C8H12N4/c1-6-9-7-4-11(2)5-12(3)8(7)10-6/h4H,5H2,1-3H3 |
| InChIKey | WHXPAMVTILSCIF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3,8-trimethyl-2H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,8-trimethyl-2H-purine?
The IUPAC name of 1,3,8-trimethyl-2H-purine (CID 141431036) is 1,3,8-trimethyl-2H-purine.
What is the SMILES notation for 1,3,8-trimethyl-2H-purine?
The canonical SMILES for 1,3,8-trimethyl-2H-purine is CC1=NC2=CN(C)CN(C)C2=N1.
What is the InChIKey of 1,3,8-trimethyl-2H-purine?
The InChIKey is WHXPAMVTILSCIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-6-9-7-4-11(2)5-12(3)8(7)10-6/h4H,5H2,1-3H3.
What are the key properties of 1,3,8-trimethyl-2H-purine?
1,3,8-trimethyl-2H-purine has a molecular weight of 164.21 g/mol, XLogP of 0.49, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,8-trimethyl-2H-purine is sourced from PubChem (CID 141431036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).