About CID 141431857
CID 141431857 (PubChem CID 141431857) has the molecular formula C6H2Br3OSi
and a molecular weight of 357.88 g/mol.
Molecular Properties
| Compound Name | CID 141431857 |
| PubChem CID | 141431857 |
| Molecular Formula | C6H2Br3OSi |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 354.74 |
| IUPAC Name | — |
| SMILES | [Si]Oc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C6H2Br3OSi/c7-3-1-2-4(10-11)6(9)5(3)8/h1-2H |
| InChIKey | PGCXYZPHAHIIHQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 141431857 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 141431857?
The IUPAC name of CID 141431857 (CID 141431857) is not available.
What is the SMILES notation for CID 141431857?
The canonical SMILES for CID 141431857 is [Si]Oc1ccc(Br)c(Br)c1Br.
What is the InChIKey of CID 141431857?
The InChIKey is PGCXYZPHAHIIHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Br3OSi/c7-3-1-2-4(10-11)6(9)5(3)8/h1-2H.
What are the key properties of CID 141431857?
CID 141431857 has a molecular weight of 357.88 g/mol, XLogP of 3.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 141431857 is sourced from PubChem (CID 141431857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).