C16H20N4O4S — CID 141432116
4-O-(2,2-diaminoethyl) 3-O-ethyl 2-(pyridin-4-ylmethylamino)thiophene-3,4-dicarboxylate (PubChem CID 141432116) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is 4-O-(2,2-diaminoethyl) 3-O-ethyl 2-(pyridin-4-ylmethylamino)thiophene-3,4-dicarboxylate.
| Compound Name | 4-O-(2,2-diaminoethyl) 3-O-ethyl 2-(pyridin-4-ylmethylamino)thiophene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 141432116 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-O-(2,2-diaminoethyl) 3-O-ethyl 2-(pyridin-4-ylmethylamino)thiophene-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC(N)N)csc1NCc1ccncc1 |
| InChI | InChI=1S/C16H20N4O4S/c1-2-23-16(22)13-11(15(21)24-8-12(17)18)9-25-14(13)20-7-10-3-5-19-6-4-10/h3-6,9,12,20H,2,7-8,17-18H2,1H3 |
| InChIKey | ARUDXEAEFQKBHM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|