About 9-benzyl-2,6-dimethoxypurine
9-benzyl-2,6-dimethoxypurine (PubChem CID 141432217) has the molecular formula C14H14N4O2
and a molecular weight of 270.29 g/mol. Its IUPAC name is 9-benzyl-2,6-dimethoxypurine.
Molecular Properties
| Compound Name | 9-benzyl-2,6-dimethoxypurine |
| PubChem CID | 141432217 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 9-benzyl-2,6-dimethoxypurine |
| SMILES | COc1nc(OC)c2ncn(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C14H14N4O2/c1-19-13-11-12(16-14(17-13)20-2)18(9-15-11)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | FNVWYTWSWHXRFI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-benzyl-2,6-dimethoxypurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-2,6-dimethoxypurine?
The IUPAC name of 9-benzyl-2,6-dimethoxypurine (CID 141432217) is 9-benzyl-2,6-dimethoxypurine.
What is the SMILES notation for 9-benzyl-2,6-dimethoxypurine?
The canonical SMILES for 9-benzyl-2,6-dimethoxypurine is COc1nc(OC)c2ncn(Cc3ccccc3)c2n1.
What is the InChIKey of 9-benzyl-2,6-dimethoxypurine?
The InChIKey is FNVWYTWSWHXRFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O2/c1-19-13-11-12(16-14(17-13)20-2)18(9-15-11)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3.
What are the key properties of 9-benzyl-2,6-dimethoxypurine?
9-benzyl-2,6-dimethoxypurine has a molecular weight of 270.29 g/mol, XLogP of 1.89, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-2,6-dimethoxypurine is sourced from PubChem (CID 141432217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).